C25H19F2N3O4 — CID 57163180
N-(2,5-difluorophenyl)-2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]anilino)propanamide (PubChem CID 57163180) has the molecular formula C25H19F2N3O4 and a molecular weight of 463.44 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]anilino)propanamide.
| Compound Name | N-(2,5-difluorophenyl)-2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]anilino)propanamide |
|---|---|
| PubChem CID | 57163180 |
| Molecular Formula | C25H19F2N3O4 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-(N-[2-(1,3-dioxoisoindol-2-yl)acetyl]anilino)propanamide |
| SMILES | CC(C(=O)Nc1cc(F)ccc1F)N(C(=O)CN1C(=O)c2ccccc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C25H19F2N3O4/c1-15(23(32)28-21-13-16(26)11-12-20(21)27)30(17-7-3-2-4-8-17)22(31)14-29-24(33)18-9-5-6-10-19(18)25(29)34/h2-13,15H,14H2,1H3,(H,28,32) |
| InChIKey | PNOWLXMXDOCDFE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|