C30H34N4O3S — CID 57171198
N-[1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-[2-(3-hydroxyphenyl)-1,4-thiazin-4-yl]butanamide (PubChem CID 57171198) has the molecular formula C30H34N4O3S and a molecular weight of 530.69 g/mol. Its IUPAC name is N-[1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-[2-(3-hydroxyphenyl)-1,4-thiazin-4-yl]butanamide.
| Compound Name | N-[1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-[2-(3-hydroxyphenyl)-1,4-thiazin-4-yl]butanamide |
|---|---|
| PubChem CID | 57171198 |
| Molecular Formula | C30H34N4O3S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | N-[1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-4-[2-(3-hydroxyphenyl)-1,4-thiazin-4-yl]butanamide |
| SMILES | NCCCNC(=O)C(Cc1ccc2ccccc2c1)NC(=O)CCCN1C=CSC(c2cccc(O)c2)=C1 |
| InChI | InChI=1S/C30H34N4O3S/c31-13-5-14-32-30(37)27(19-22-11-12-23-6-1-2-7-24(23)18-22)33-29(36)10-4-15-34-16-17-38-28(21-34)25-8-3-9-26(35)20-25/h1-3,6-9,11-12,16-18,20-21,27,35H,4-5,10,13-15,19,31H2,(H,32,37)(H,33,36) |
| InChIKey | LBWSLTVHGZQKBS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|