C14H16N4O3S — CID 57182085
3-hydrazinyl-2-methyl-6-[(2-methylphenyl)diazenyl]benzenesulfonic acid (PubChem CID 57182085) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 3-hydrazinyl-2-methyl-6-[(2-methylphenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 3-hydrazinyl-2-methyl-6-[(2-methylphenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 57182085 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3-hydrazinyl-2-methyl-6-[(2-methylphenyl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1ccccc1/N=N/c1ccc(NN)c(C)c1S(=O)(=O)O |
| InChI | InChI=1S/C14H16N4O3S/c1-9-5-3-4-6-11(9)17-18-13-8-7-12(16-15)10(2)14(13)22(19,20)21/h3-8,16H,15H2,1-2H3,(H,19,20,21)/b18-17+ |
| InChIKey | VAFWFHIEZBCHHZ-ISLYRVAYSA-N |
| XLogP | 3.25 |
| TPSA | 117.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|