C14H18O4 — CID 57182313
ethyl 4-(6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)-2,3-dioxobutanoate (PubChem CID 57182313) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is ethyl 4-(6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)-2,3-dioxobutanoate.
| Compound Name | ethyl 4-(6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)-2,3-dioxobutanoate |
|---|---|
| PubChem CID | 57182313 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | ethyl 4-(6,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl)-2,3-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)C(=O)CC1=CCC2C1C2(C)C |
| InChI | InChI=1S/C14H18O4/c1-4-18-13(17)12(16)10(15)7-8-5-6-9-11(8)14(9,2)3/h5,9,11H,4,6-7H2,1-3H3 |
| InChIKey | WGYBJHRTURLFEJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|