About N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide
N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide (PubChem CID 57182464) has the molecular formula C19H32N2
and a molecular weight of 288.48 g/mol. Its IUPAC name is N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide.
Molecular Properties
| Compound Name | N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide |
| PubChem CID | 57182464 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide |
| SMILES | CCCCCN(/C=N/c1ccc(C)c(C)c1)CCCCC |
| InChI | InChI=1S/C19H32N2/c1-5-7-9-13-21(14-10-8-6-2)16-20-19-12-11-17(3)18(4)15-19/h11-12,15-16H,5-10,13-14H2,1-4H3/b20-16+ |
| InChIKey | AMNRFVDRBROSGR-CAPFRKAQSA-N |
| XLogP | 5.65 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide?
The IUPAC name of N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide (CID 57182464) is N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide.
What is the SMILES notation for N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide?
The canonical SMILES for N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide is CCCCCN(/C=N/c1ccc(C)c(C)c1)CCCCC.
What is the InChIKey of N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide?
The InChIKey is AMNRFVDRBROSGR-CAPFRKAQSA-N. The full InChI is InChI=1S/C19H32N2/c1-5-7-9-13-21(14-10-8-6-2)16-20-19-12-11-17(3)18(4)15-19/h11-12,15-16H,5-10,13-14H2,1-4H3/b20-16+.
What are the key properties of N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide?
N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide has a molecular weight of 288.48 g/mol, XLogP of 5.65, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,4-dimethylphenyl)-N,N-dipentylmethanimidamide is sourced from PubChem (CID 57182464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).