C24H23N3O4S — CID 57184675
1-phenylpropyl 2,6-dimethyl-3-nitro-4-thieno[3,2-c]pyridin-3-yl-3,4-dihydropyridine-5-carboxylate (PubChem CID 57184675) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 1-phenylpropyl 2,6-dimethyl-3-nitro-4-thieno[3,2-c]pyridin-3-yl-3,4-dihydropyridine-5-carboxylate.
| Compound Name | 1-phenylpropyl 2,6-dimethyl-3-nitro-4-thieno[3,2-c]pyridin-3-yl-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 57184675 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 1-phenylpropyl 2,6-dimethyl-3-nitro-4-thieno[3,2-c]pyridin-3-yl-3,4-dihydropyridine-5-carboxylate |
| SMILES | CCC(OC(=O)C1=C(C)N=C(C)C([N+](=O)[O-])C1c1csc2ccncc12)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O4S/c1-4-19(16-8-6-5-7-9-16)31-24(28)21-14(2)26-15(3)23(27(29)30)22(21)18-13-32-20-10-11-25-12-17(18)20/h5-13,19,22-23H,4H2,1-3H3 |
| InChIKey | DWOABHYXSZTTFJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 94.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|