C15H11ClF3NO4S — CID 57191246
3-[[2-chloro-4-(trifluoromethyl)phenoxy]methylsulfonyl]benzamide (PubChem CID 57191246) has the molecular formula C15H11ClF3NO4S and a molecular weight of 393.77 g/mol. Its IUPAC name is 3-[[2-chloro-4-(trifluoromethyl)phenoxy]methylsulfonyl]benzamide.
| Compound Name | 3-[[2-chloro-4-(trifluoromethyl)phenoxy]methylsulfonyl]benzamide |
|---|---|
| PubChem CID | 57191246 |
| Molecular Formula | C15H11ClF3NO4S |
| Molecular Weight | 393.77 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 3-[[2-chloro-4-(trifluoromethyl)phenoxy]methylsulfonyl]benzamide |
| SMILES | NC(=O)c1cccc(S(=O)(=O)COc2ccc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C15H11ClF3NO4S/c16-12-7-10(15(17,18)19)4-5-13(12)24-8-25(22,23)11-3-1-2-9(6-11)14(20)21/h1-7H,8H2,(H2,20,21) |
| InChIKey | YMIJVLOKIVSLHF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.77 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |