C19H28ClN3O4 — CID 57195500
(2R)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-(4-chlorophenyl)propyl]-N-hydroxybutanediamide (PubChem CID 57195500) has the molecular formula C19H28ClN3O4 and a molecular weight of 397.90 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-(4-chlorophenyl)propyl]-N-hydroxybutanediamide.
| Compound Name | (2R)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-(4-chlorophenyl)propyl]-N-hydroxybutanediamide |
|---|---|
| PubChem CID | 57195500 |
| Molecular Formula | C19H28ClN3O4 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | (2R)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-2-[3-(4-chlorophenyl)propyl]-N-hydroxybutanediamide |
| SMILES | CC(C)(C)[C@@H](C(N)=O)N(O)C(=O)[C@H](CCCc1ccc(Cl)cc1)CC(N)=O |
| InChI | InChI=1S/C19H28ClN3O4/c1-19(2,3)16(17(22)25)23(27)18(26)13(11-15(21)24)6-4-5-12-7-9-14(20)10-8-12/h7-10,13,16,27H,4-6,11H2,1-3H3,(H2,21,24)(H2,22,25)/t13-,16-/m1/s1 |
| InChIKey | DGGQULSJKSQYAA-CZUORRHYSA-N |
| XLogP | 2.27 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|