C13H12N2O3S2 — CID 57195972
[[3-(cyanomethyl)thiophen-2-yl]amino] 4-methylbenzenesulfonate (PubChem CID 57195972) has the molecular formula C13H12N2O3S2 and a molecular weight of 308.38 g/mol. Its IUPAC name is [[3-(cyanomethyl)thiophen-2-yl]amino] 4-methylbenzenesulfonate.
| Compound Name | [[3-(cyanomethyl)thiophen-2-yl]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57195972 |
| Molecular Formula | C13H12N2O3S2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | [[3-(cyanomethyl)thiophen-2-yl]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ONc2sccc2CC#N)cc1 |
| InChI | InChI=1S/C13H12N2O3S2/c1-10-2-4-12(5-3-10)20(16,17)18-15-13-11(6-8-14)7-9-19-13/h2-5,7,9,15H,6H2,1H3 |
| InChIKey | JVCXLZQJCJHMKZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|