C22H28N2O6 — CID 57215681
3-[5-[7-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]heptyl]-1,2-oxazol-3-yl]-3-hydroxypropanoic acid (PubChem CID 57215681) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 3-[5-[7-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]heptyl]-1,2-oxazol-3-yl]-3-hydroxypropanoic acid.
| Compound Name | 3-[5-[7-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]heptyl]-1,2-oxazol-3-yl]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 57215681 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 3-[5-[7-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]heptyl]-1,2-oxazol-3-yl]-3-hydroxypropanoic acid |
| SMILES | O=C(O)CC(O)c1cc(CCCCCCCOc2ccc(C3=NCCO3)cc2)on1 |
| InChI | InChI=1S/C22H28N2O6/c25-20(15-21(26)27)19-14-18(30-24-19)6-4-2-1-3-5-12-28-17-9-7-16(8-10-17)22-23-11-13-29-22/h7-10,14,20,25H,1-6,11-13,15H2,(H,26,27) |
| InChIKey | DALSMASTOALZAJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|