C16H25NO — CID 57225946
(2S,3S,5S)-2-amino-1-phenyl-5-propan-2-ylhept-6-en-3-ol (PubChem CID 57225946) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (2S,3S,5S)-2-amino-1-phenyl-5-propan-2-ylhept-6-en-3-ol.
| Compound Name | (2S,3S,5S)-2-amino-1-phenyl-5-propan-2-ylhept-6-en-3-ol |
|---|---|
| PubChem CID | 57225946 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (2S,3S,5S)-2-amino-1-phenyl-5-propan-2-ylhept-6-en-3-ol |
| SMILES | C=CC(C[C@H](O)[C@@H](N)Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C16H25NO/c1-4-14(12(2)3)11-16(18)15(17)10-13-8-6-5-7-9-13/h4-9,12,14-16,18H,1,10-11,17H2,2-3H3/t14?,15-,16-/m0/s1 |
| InChIKey | FUBWZWZBERGQJB-YVZMLIKISA-N |
| XLogP | 2.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|