About 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane
2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane (PubChem CID 57226131) has the molecular formula C16H13BrCl2O2
and a molecular weight of 388.09 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane |
| PubChem CID | 57226131 |
| Molecular Formula | C16H13BrCl2O2 |
| Molecular Weight | 388.09 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane |
| SMILES | CC1COC(c2ccc(Br)cc2)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C16H13BrCl2O2/c1-10-9-20-16(21-10,11-2-4-12(17)5-3-11)14-7-6-13(18)8-15(14)19/h2-8,10H,9H2,1H3 |
| InChIKey | YEHMZTWMPGZKPP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.09 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane?
The IUPAC name of 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane (CID 57226131) is 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane.
What is the SMILES notation for 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane?
The canonical SMILES for 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane is CC1COC(c2ccc(Br)cc2)(c2ccc(Cl)cc2Cl)O1.
What is the InChIKey of 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane?
The InChIKey is YEHMZTWMPGZKPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrCl2O2/c1-10-9-20-16(21-10,11-2-4-12(17)5-3-11)14-7-6-13(18)8-15(14)19/h2-8,10H,9H2,1H3.
What are the key properties of 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane?
2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane has a molecular weight of 388.09 g/mol, XLogP of 5.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane is sourced from PubChem (CID 57226131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).