C20H16F3N3O4 — CID 57227349
[1-carbamoyl-3-[4-carbamoyl-2-(trifluoromethyl)phenyl]indol-5-yl] propanoate (PubChem CID 57227349) has the molecular formula C20H16F3N3O4 and a molecular weight of 419.36 g/mol. Its IUPAC name is [1-carbamoyl-3-[4-carbamoyl-2-(trifluoromethyl)phenyl]indol-5-yl] propanoate.
| Compound Name | [1-carbamoyl-3-[4-carbamoyl-2-(trifluoromethyl)phenyl]indol-5-yl] propanoate |
|---|---|
| PubChem CID | 57227349 |
| Molecular Formula | C20H16F3N3O4 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | [1-carbamoyl-3-[4-carbamoyl-2-(trifluoromethyl)phenyl]indol-5-yl] propanoate |
| SMILES | CCC(=O)Oc1ccc2c(c1)c(-c1ccc(C(N)=O)cc1C(F)(F)F)cn2C(N)=O |
| InChI | InChI=1S/C20H16F3N3O4/c1-2-17(27)30-11-4-6-16-13(8-11)14(9-26(16)19(25)29)12-5-3-10(18(24)28)7-15(12)20(21,22)23/h3-9H,2H2,1H3,(H2,24,28)(H2,25,29) |
| InChIKey | KARMNMYGJGGHPY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|