C22H37NO6S2 — CID 57232607
2-[[2-[(2S,3S)-3-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-yl]oxyacetyl]amino]ethanesulfonic acid (PubChem CID 57232607) has the molecular formula C22H37NO6S2 and a molecular weight of 475.67 g/mol. Its IUPAC name is 2-[[2-[(2S,3S)-3-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-yl]oxyacetyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-[(2S,3S)-3-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-yl]oxyacetyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 57232607 |
| Molecular Formula | C22H37NO6S2 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-[[2-[(2S,3S)-3-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-yl]oxyacetyl]amino]ethanesulfonic acid |
| SMILES | C[C@H](OCC(=O)NCCS(=O)(=O)O)[C@H](C)Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H37NO6S2/c1-14(29-13-19(24)23-9-10-31(26,27)28)15(2)30-16-11-17(21(3,4)5)20(25)18(12-16)22(6,7)8/h11-12,14-15,25H,9-10,13H2,1-8H3,(H,23,24)(H,26,27,28)/t14-,15-/m0/s1 |
| InChIKey | CQOGWDYWEJSQMM-GJZGRUSLSA-N |
| XLogP | 3.88 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|