C26H52N10 — CID 57233814
N-[18-(butan-2-ylideneamino)-9,11,15,17-tetradiazenyloctadecyl]butan-2-imine (PubChem CID 57233814) has the molecular formula C26H52N10 and a molecular weight of 504.77 g/mol. Its IUPAC name is N-[18-(butan-2-ylideneamino)-9,11,15,17-tetradiazenyloctadecyl]butan-2-imine.
| Compound Name | N-[18-(butan-2-ylideneamino)-9,11,15,17-tetradiazenyloctadecyl]butan-2-imine |
|---|---|
| PubChem CID | 57233814 |
| Molecular Formula | C26H52N10 |
| Molecular Weight | 504.77 g/mol |
| Exact Mass | 504.44 |
| IUPAC Name | N-[18-(butan-2-ylideneamino)-9,11,15,17-tetradiazenyloctadecyl]butan-2-imine |
| SMILES | [H]/N=N/C(CCCCCCCC/N=C(\C)CC)CC(CCCC(CC(C/N=C(\C)CC)/N=N/[H])/N=N/[H])/N=N/[H] |
| InChI | InChI=1S/C26H52N10/c1-5-21(3)31-17-12-10-8-7-9-11-14-23(33-27)18-24(34-28)15-13-16-25(35-29)19-26(36-30)20-32-22(4)6-2/h23-30H,5-20H2,1-4H3/b31-21+,32-22+,33-27+,34-28+,35-29+,36-30+ |
| InChIKey | ASXMOPQSGPTOBO-IWFWEPESSA-N |
| XLogP | 9.01 |
| TPSA | 169.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.77 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|