C19H31N5O5 — CID 57236706
N-formyl-2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)-N-piperazin-1-ylacetamide (PubChem CID 57236706) has the molecular formula C19H31N5O5 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-formyl-2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)-N-piperazin-1-ylacetamide.
| Compound Name | N-formyl-2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)-N-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 57236706 |
| Molecular Formula | C19H31N5O5 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-formyl-2-(5-octyl-2,4,6-trioxo-1,3-diazinan-5-yl)-N-piperazin-1-ylacetamide |
| SMILES | CCCCCCCCC1(CC(=O)N(C=O)N2CCNCC2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C19H31N5O5/c1-2-3-4-5-6-7-8-19(16(27)21-18(29)22-17(19)28)13-15(26)24(14-25)23-11-9-20-10-12-23/h14,20H,2-13H2,1H3,(H2,21,22,27,28,29) |
| InChIKey | JASXVUFPGLCOEV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|