C10H14O4 — CID 57238327
(7S)-1-hydroxy-7-methyl-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid (PubChem CID 57238327) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (7S)-1-hydroxy-7-methyl-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid.
| Compound Name | (7S)-1-hydroxy-7-methyl-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
|---|---|
| PubChem CID | 57238327 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (7S)-1-hydroxy-7-methyl-1,3,4,4a,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
| SMILES | CC1C=CC2C(C(=O)O)COC(O)C12 |
| InChI | InChI=1S/C10H14O4/c1-5-2-3-6-7(9(11)12)4-14-10(13)8(5)6/h2-3,5-8,10,13H,4H2,1H3,(H,11,12) |
| InChIKey | JCSQEVLEPBYOOI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|