C10H13ClN2 — CID 57252553
(1S)-1-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-7-amine (PubChem CID 57252553) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is (1S)-1-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-7-amine.
| Compound Name | (1S)-1-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-7-amine |
|---|---|
| PubChem CID | 57252553 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (1S)-1-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-7-amine |
| SMILES | CN1CCc2ccc(N)cc2[C@@H]1Cl |
| InChI | InChI=1S/C10H13ClN2/c1-13-5-4-7-2-3-8(12)6-9(7)10(13)11/h2-3,6,10H,4-5,12H2,1H3/t10-/m1/s1 |
| InChIKey | OLBKWIDUEJUAAP-SNVBAGLBSA-N |
| XLogP | 1.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|