C15H19F3N2O3 — CID 57253948
ethyl 2-(methylamino)-2-[4-(2,3,6-trifluorophenyl)morpholin-2-yl]acetate (PubChem CID 57253948) has the molecular formula C15H19F3N2O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is ethyl 2-(methylamino)-2-[4-(2,3,6-trifluorophenyl)morpholin-2-yl]acetate.
| Compound Name | ethyl 2-(methylamino)-2-[4-(2,3,6-trifluorophenyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 57253948 |
| Molecular Formula | C15H19F3N2O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl 2-(methylamino)-2-[4-(2,3,6-trifluorophenyl)morpholin-2-yl]acetate |
| SMILES | CCOC(=O)C(NC)C1CN(c2c(F)ccc(F)c2F)CCO1 |
| InChI | InChI=1S/C15H19F3N2O3/c1-3-22-15(21)13(19-2)11-8-20(6-7-23-11)14-10(17)5-4-9(16)12(14)18/h4-5,11,13,19H,3,6-8H2,1-2H3 |
| InChIKey | LEBSOKAWWKJRQJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|