C22H27ClN4O4S2 — CID 57259824
1-[4-[4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-1-carbonyl]cyclohexyl]-1-sulfanylurea (PubChem CID 57259824) has the molecular formula C22H27ClN4O4S2 and a molecular weight of 511.07 g/mol. Its IUPAC name is 1-[4-[4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-1-carbonyl]cyclohexyl]-1-sulfanylurea.
| Compound Name | 1-[4-[4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-1-carbonyl]cyclohexyl]-1-sulfanylurea |
|---|---|
| PubChem CID | 57259824 |
| Molecular Formula | C22H27ClN4O4S2 |
| Molecular Weight | 511.07 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 1-[4-[4-(6-chloronaphthalen-2-yl)sulfonylpiperazine-1-carbonyl]cyclohexyl]-1-sulfanylurea |
| SMILES | NC(=O)N(S)C1CCC(C(=O)N2CCN(S(=O)(=O)c3ccc4cc(Cl)ccc4c3)CC2)CC1 |
| InChI | InChI=1S/C22H27ClN4O4S2/c23-18-5-1-17-14-20(8-4-16(17)13-18)33(30,31)26-11-9-25(10-12-26)21(28)15-2-6-19(7-3-15)27(32)22(24)29/h1,4-5,8,13-15,19,32H,2-3,6-7,9-12H2,(H2,24,29) |
| InChIKey | BQKSAPIRVRRULJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.07 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|