C19H21N3 — CID 57263996
N-(1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylideneamino)aniline (PubChem CID 57263996) has the molecular formula C19H21N3 and a molecular weight of 291.40 g/mol. Its IUPAC name is N-(1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylideneamino)aniline.
| Compound Name | N-(1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylideneamino)aniline |
|---|---|
| PubChem CID | 57263996 |
| Molecular Formula | C19H21N3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-(1,3,4,6,7,11b-hexahydrobenzo[a]quinolizin-2-ylideneamino)aniline |
| SMILES | c1ccc(NN=C2CCN3CCc4ccccc4C3C2)cc1 |
| InChI | InChI=1S/C19H21N3/c1-2-7-16(8-3-1)20-21-17-11-13-22-12-10-15-6-4-5-9-18(15)19(22)14-17/h1-9,19-20H,10-14H2 |
| InChIKey | IUJNWERAMUJVAD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|