C6H6ClF — CID 57264476
6-chloro-4-fluorohexa-1,2,4-triene (PubChem CID 57264476) has the molecular formula C6H6ClF and a molecular weight of 132.56 g/mol. Its IUPAC name is 6-chloro-4-fluorohexa-1,2,4-triene.
| Compound Name | 6-chloro-4-fluorohexa-1,2,4-triene |
|---|---|
| PubChem CID | 57264476 |
| Molecular Formula | C6H6ClF |
| Molecular Weight | 132.56 g/mol |
| Exact Mass | 132.01 |
| IUPAC Name | 6-chloro-4-fluorohexa-1,2,4-triene |
| SMILES | C=C=CC(F)=CCCl |
| InChI | InChI=1S/C6H6ClF/c1-2-3-6(8)4-5-7/h3-4H,1,5H2 |
| InChIKey | PFENTXSMRXLXFC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.56 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|