C11H16N6O4 — CID 57265073
(2S,3S)-2-[2-amino-6-(methoxyamino)purin-7-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 57265073) has the molecular formula C11H16N6O4 and a molecular weight of 296.29 g/mol. Its IUPAC name is (2S,3S)-2-[2-amino-6-(methoxyamino)purin-7-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2S,3S)-2-[2-amino-6-(methoxyamino)purin-7-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 57265073 |
| Molecular Formula | C11H16N6O4 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (2S,3S)-2-[2-amino-6-(methoxyamino)purin-7-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CONc1nc(N)nc2ncn([C@@]3(CO)OCC[C@@H]3O)c12 |
| InChI | InChI=1S/C11H16N6O4/c1-20-16-9-7-8(14-10(12)15-9)13-5-17(7)11(4-18)6(19)2-3-21-11/h5-6,18-19H,2-4H2,1H3,(H3,12,14,15,16)/t6-,11-/m0/s1 |
| InChIKey | RJIIYUJJIDZDOB-KGFZYKRKSA-N |
| XLogP | -1.19 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|