C24H20N4 — CID 57266004
1-N-(4-aminophenyl)-1-N-phenyl-9H-carbazole-1,4-diamine (PubChem CID 57266004) has the molecular formula C24H20N4 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-N-(4-aminophenyl)-1-N-phenyl-9H-carbazole-1,4-diamine.
| Compound Name | 1-N-(4-aminophenyl)-1-N-phenyl-9H-carbazole-1,4-diamine |
|---|---|
| PubChem CID | 57266004 |
| Molecular Formula | C24H20N4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-N-(4-aminophenyl)-1-N-phenyl-9H-carbazole-1,4-diamine |
| SMILES | Nc1ccc(N(c2ccccc2)c2ccc(N)c3c2[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C24H20N4/c25-16-10-12-18(13-11-16)28(17-6-2-1-3-7-17)22-15-14-20(26)23-19-8-4-5-9-21(19)27-24(22)23/h1-15,27H,25-26H2 |
| InChIKey | CQRPSVJZXLJXKR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 71.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|