C16H21N3O6P2 — CID 57269219
2-[2-diazo-5-phenylimino-4-(2-phosphonoethyl)cyclohex-3-en-1-yl]ethylphosphonic acid (PubChem CID 57269219) has the molecular formula C16H21N3O6P2 and a molecular weight of 413.31 g/mol. Its IUPAC name is 2-[2-diazo-5-phenylimino-4-(2-phosphonoethyl)cyclohex-3-en-1-yl]ethylphosphonic acid.
| Compound Name | 2-[2-diazo-5-phenylimino-4-(2-phosphonoethyl)cyclohex-3-en-1-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 57269219 |
| Molecular Formula | C16H21N3O6P2 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[2-diazo-5-phenylimino-4-(2-phosphonoethyl)cyclohex-3-en-1-yl]ethylphosphonic acid |
| SMILES | [N-]=[N+]=C1C=C(CCP(=O)(O)O)/C(=N/c2ccccc2)CC1CCP(=O)(O)O |
| InChI | InChI=1S/C16H21N3O6P2/c17-19-16-11-12(6-8-26(20,21)22)15(18-14-4-2-1-3-5-14)10-13(16)7-9-27(23,24)25/h1-5,11,13H,6-10H2,(H2,20,21,22)(H2,23,24,25)/b18-15+ |
| InChIKey | RWVGGIQUTZJFDH-OBGWFSINSA-N |
| XLogP | 2.51 |
| TPSA | 163.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|