About 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride
3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride (PubChem CID 88727138) has the molecular formula C10H9ClN2O4S
and a molecular weight of 288.71 g/mol. Its IUPAC name is 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride |
| PubChem CID | 88727138 |
| Molecular Formula | C10H9ClN2O4S |
| Molecular Weight | 288.71 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride |
| SMILES | Cl.[N-]=[N+]=C1C=c2ccccc2=C(O)C1S(=O)(=O)O |
| InChI | InChI=1S/C10H8N2O4S.ClH/c11-12-8-5-6-3-1-2-4-7(6)9(13)10(8)17(14,15)16;/h1-5,10,13H,(H,14,15,16);1H |
| InChIKey | LNKNNKSOFYYWAK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.71 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride?
The IUPAC name of 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride (CID 88727138) is 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride.
What is the SMILES notation for 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride?
The canonical SMILES for 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride is Cl.[N-]=[N+]=C1C=c2ccccc2=C(O)C1S(=O)(=O)O.
What is the InChIKey of 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride?
The InChIKey is LNKNNKSOFYYWAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4S.ClH/c11-12-8-5-6-3-1-2-4-7(6)9(13)10(8)17(14,15)16;/h1-5,10,13H,(H,14,15,16);1H.
What are the key properties of 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride?
3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride has a molecular weight of 288.71 g/mol, XLogP of -0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazo-1-hydroxy-2H-naphthalene-2-sulfonic acid;hydrochloride is sourced from PubChem (CID 88727138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).