C10H8N2O4S — CID 92977207
(5S)-6-diazo-5-hydroxy-5H-naphthalene-1-sulfonic acid (PubChem CID 92977207) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is (5S)-6-diazo-5-hydroxy-5H-naphthalene-1-sulfonic acid.
| Compound Name | (5S)-6-diazo-5-hydroxy-5H-naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 92977207 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | (5S)-6-diazo-5-hydroxy-5H-naphthalene-1-sulfonic acid |
| SMILES | [N-]=[N+]=C1C=Cc2c(cccc2S(=O)(=O)O)[C@@H]1O |
| InChI | InChI=1S/C10H8N2O4S/c11-12-8-5-4-6-7(10(8)13)2-1-3-9(6)17(14,15)16/h1-5,10,13H,(H,14,15,16)/t10-/m0/s1 |
| InChIKey | VCZWVTLNUKKQER-JTQLQIEISA-N |
| XLogP | 0.66 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|