C25H14O7S2 — CID 57273818
bis(10,10-dioxophenoxathiin-1-yl)methanone (PubChem CID 57273818) has the molecular formula C25H14O7S2 and a molecular weight of 490.51 g/mol. Its IUPAC name is bis(10,10-dioxophenoxathiin-1-yl)methanone.
| Compound Name | bis(10,10-dioxophenoxathiin-1-yl)methanone |
|---|---|
| PubChem CID | 57273818 |
| Molecular Formula | C25H14O7S2 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | bis(10,10-dioxophenoxathiin-1-yl)methanone |
| SMILES | O=C(c1cccc2c1S(=O)(=O)c1ccccc1O2)c1cccc2c1S(=O)(=O)c1ccccc1O2 |
| InChI | InChI=1S/C25H14O7S2/c26-23(15-7-5-11-19-24(15)33(27,28)21-13-3-1-9-17(21)31-19)16-8-6-12-20-25(16)34(29,30)22-14-4-2-10-18(22)32-20/h1-14H |
| InChIKey | VIYXOXAGXHCTET-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |