C10H18O2 — CID 57275472
2-propylidenehept-3-ene-1,5-diol (PubChem CID 57275472) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-propylidenehept-3-ene-1,5-diol.
| Compound Name | 2-propylidenehept-3-ene-1,5-diol |
|---|---|
| PubChem CID | 57275472 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-propylidenehept-3-ene-1,5-diol |
| SMILES | CCC=C(C=CC(O)CC)CO |
| InChI | InChI=1S/C10H18O2/c1-3-5-9(8-11)6-7-10(12)4-2/h5-7,10-12H,3-4,8H2,1-2H3 |
| InChIKey | MCCQYILWXLTUON-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|