C23H39NO6Si — CID 57297599
[(1R)-1-[(2R,3S)-2-[(1S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxocyclohexyl]-4-oxoazetidin-3-yl]ethyl] prop-2-enyl carbonate (PubChem CID 57297599) has the molecular formula C23H39NO6Si and a molecular weight of 453.65 g/mol. Its IUPAC name is [(1R)-1-[(2R,3S)-2-[(1S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxocyclohexyl]-4-oxoazetidin-3-yl]ethyl] prop-2-enyl carbonate.
| Compound Name | [(1R)-1-[(2R,3S)-2-[(1S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxocyclohexyl]-4-oxoazetidin-3-yl]ethyl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 57297599 |
| Molecular Formula | C23H39NO6Si |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | [(1R)-1-[(2R,3S)-2-[(1S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxocyclohexyl]-4-oxoazetidin-3-yl]ethyl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)O[C@H](C)[C@H]1C(=O)N[C@@H]1[C@@H]1CCCC(CCO[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C23H39NO6Si/c1-8-13-28-22(27)30-15(2)18-19(24-21(18)26)17-11-9-10-16(20(17)25)12-14-29-31(6,7)23(3,4)5/h8,15-19H,1,9-14H2,2-7H3,(H,24,26)/t15-,16?,17+,18-,19-/m1/s1 |
| InChIKey | NAHYXHHYXIUXBB-MGHBKMGSSA-N |
| XLogP | 4.23 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|