C15H32O6 — CID 57297918
5-(2-ethoxypropoxy)-2-(2-methoxypropoxy)hexane-1,4-diol (PubChem CID 57297918) has the molecular formula C15H32O6 and a molecular weight of 308.42 g/mol. Its IUPAC name is 5-(2-ethoxypropoxy)-2-(2-methoxypropoxy)hexane-1,4-diol.
| Compound Name | 5-(2-ethoxypropoxy)-2-(2-methoxypropoxy)hexane-1,4-diol |
|---|---|
| PubChem CID | 57297918 |
| Molecular Formula | C15H32O6 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 5-(2-ethoxypropoxy)-2-(2-methoxypropoxy)hexane-1,4-diol |
| SMILES | CCOC(C)COC(C)C(O)CC(CO)OCC(C)OC |
| InChI | InChI=1S/C15H32O6/c1-6-19-12(3)10-20-13(4)15(17)7-14(8-16)21-9-11(2)18-5/h11-17H,6-10H2,1-5H3 |
| InChIKey | FZXXQRMNUGHNAL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |