C26H32O2 — CID 57298170
2-cyclopentyloxy-4-(3-ethyl-1-phenylhex-1-yn-3-yl)-1-methoxybenzene (PubChem CID 57298170) has the molecular formula C26H32O2 and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-cyclopentyloxy-4-(3-ethyl-1-phenylhex-1-yn-3-yl)-1-methoxybenzene.
| Compound Name | 2-cyclopentyloxy-4-(3-ethyl-1-phenylhex-1-yn-3-yl)-1-methoxybenzene |
|---|---|
| PubChem CID | 57298170 |
| Molecular Formula | C26H32O2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 2-cyclopentyloxy-4-(3-ethyl-1-phenylhex-1-yn-3-yl)-1-methoxybenzene |
| SMILES | CCCC(C#Cc1ccccc1)(CC)c1ccc(OC)c(OC2CCCC2)c1 |
| InChI | InChI=1S/C26H32O2/c1-4-18-26(5-2,19-17-21-11-7-6-8-12-21)22-15-16-24(27-3)25(20-22)28-23-13-9-10-14-23/h6-8,11-12,15-16,20,23H,4-5,9-10,13-14,18H2,1-3H3 |
| InChIKey | YHYOJHKAHXKOGD-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|