C24H27NO4 — CID 57235125
3-(3-cyclopentyloxy-4-methoxyphenyl)-3-methoxy-5-phenylpent-4-ynamide (PubChem CID 57235125) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 3-(3-cyclopentyloxy-4-methoxyphenyl)-3-methoxy-5-phenylpent-4-ynamide.
| Compound Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-3-methoxy-5-phenylpent-4-ynamide |
|---|---|
| PubChem CID | 57235125 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-3-methoxy-5-phenylpent-4-ynamide |
| SMILES | COc1ccc(C(C#Cc2ccccc2)(CC(N)=O)OC)cc1OC1CCCC1 |
| InChI | InChI=1S/C24H27NO4/c1-27-21-13-12-19(16-22(21)29-20-10-6-7-11-20)24(28-2,17-23(25)26)15-14-18-8-4-3-5-9-18/h3-5,8-9,12-13,16,20H,6-7,10-11,17H2,1-2H3,(H2,25,26) |
| InChIKey | FIRCODKWLABWJB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|