C24H27NO3 — CID 56987832
3-(3-cyclopentyloxy-4-methoxyphenyl)-3-methyl-5-phenylpent-4-ynamide (PubChem CID 56987832) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 3-(3-cyclopentyloxy-4-methoxyphenyl)-3-methyl-5-phenylpent-4-ynamide.
| Compound Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-3-methyl-5-phenylpent-4-ynamide |
|---|---|
| PubChem CID | 56987832 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-3-methyl-5-phenylpent-4-ynamide |
| SMILES | COc1ccc(C(C)(C#Cc2ccccc2)CC(N)=O)cc1OC1CCCC1 |
| InChI | InChI=1S/C24H27NO3/c1-24(17-23(25)26,15-14-18-8-4-3-5-9-18)19-12-13-21(27-2)22(16-19)28-20-10-6-7-11-20/h3-5,8-9,12-13,16,20H,6-7,10-11,17H2,1-2H3,(H2,25,26) |
| InChIKey | KSHVGRMBUBIJNX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|