C19H20FNO2S — CID 57301144
N-[cyclopentylidene-(3-fluoro-4-methylphenyl)methyl]benzenesulfonamide (PubChem CID 57301144) has the molecular formula C19H20FNO2S and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[cyclopentylidene-(3-fluoro-4-methylphenyl)methyl]benzenesulfonamide.
| Compound Name | N-[cyclopentylidene-(3-fluoro-4-methylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 57301144 |
| Molecular Formula | C19H20FNO2S |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[cyclopentylidene-(3-fluoro-4-methylphenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(NS(=O)(=O)c2ccccc2)=C2CCCC2)cc1F |
| InChI | InChI=1S/C19H20FNO2S/c1-14-11-12-16(13-18(14)20)19(15-7-5-6-8-15)21-24(22,23)17-9-3-2-4-10-17/h2-4,9-13,21H,5-8H2,1H3 |
| InChIKey | MGUJBFLLUUJUDV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |