C24H34ClN3O — CID 57304352
5-[1-(4-chlorophenyl)ethenyl]-3,3-dimethyl-N-[1-(4-methylpiperazin-1-yl)propoxy]cyclohexa-1,5-dien-1-amine (PubChem CID 57304352) has the molecular formula C24H34ClN3O and a molecular weight of 416.01 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)ethenyl]-3,3-dimethyl-N-[1-(4-methylpiperazin-1-yl)propoxy]cyclohexa-1,5-dien-1-amine.
| Compound Name | 5-[1-(4-chlorophenyl)ethenyl]-3,3-dimethyl-N-[1-(4-methylpiperazin-1-yl)propoxy]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 57304352 |
| Molecular Formula | C24H34ClN3O |
| Molecular Weight | 416.01 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 5-[1-(4-chlorophenyl)ethenyl]-3,3-dimethyl-N-[1-(4-methylpiperazin-1-yl)propoxy]cyclohexa-1,5-dien-1-amine |
| SMILES | C=C(C1=CC(NOC(CC)N2CCN(C)CC2)=CC(C)(C)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H34ClN3O/c1-6-23(28-13-11-27(5)12-14-28)29-26-22-15-20(16-24(3,4)17-22)18(2)19-7-9-21(25)10-8-19/h7-10,15,17,23,26H,2,6,11-14,16H2,1,3-5H3 |
| InChIKey | NXCSLUJSGBWNOS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.01 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|