C25H29N3O3 — CID 57310082
tert-butyl N-(2-aminoquinolin-3-yl)-N-(5-phenylpentanoyl)carbamate (PubChem CID 57310082) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is tert-butyl N-(2-aminoquinolin-3-yl)-N-(5-phenylpentanoyl)carbamate.
| Compound Name | tert-butyl N-(2-aminoquinolin-3-yl)-N-(5-phenylpentanoyl)carbamate |
|---|---|
| PubChem CID | 57310082 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | tert-butyl N-(2-aminoquinolin-3-yl)-N-(5-phenylpentanoyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)CCCCc1ccccc1)c1cc2ccccc2nc1N |
| InChI | InChI=1S/C25H29N3O3/c1-25(2,3)31-24(30)28(21-17-19-14-8-9-15-20(19)27-23(21)26)22(29)16-10-7-13-18-11-5-4-6-12-18/h4-6,8-9,11-12,14-15,17H,7,10,13,16H2,1-3H3,(H2,26,27) |
| InChIKey | ZGVKVLCECCRDME-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|