C20H21NO5S — CID 57312214
phenyl 3-ethyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 57312214) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is phenyl 3-ethyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carboxylate.
| Compound Name | phenyl 3-ethyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57312214 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | phenyl 3-ethyl-1-(4-methylphenyl)sulfonyl-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCC1CC(=O)N(S(=O)(=O)c2ccc(C)cc2)C1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H21NO5S/c1-3-15-13-18(22)21(27(24,25)17-11-9-14(2)10-12-17)19(15)20(23)26-16-7-5-4-6-8-16/h4-12,15,19H,3,13H2,1-2H3 |
| InChIKey | OENFQSMSEZSCEM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|