C17H18N3S+ — CID 57316813
3-methyl-2-[(E)-2-(N-methylanilino)ethenyl]-1,3-benzothiazol-3-ium-6-amine (PubChem CID 57316813) has the molecular formula C17H18N3S+ and a molecular weight of 296.42 g/mol. Its IUPAC name is 3-methyl-2-[(E)-2-(N-methylanilino)ethenyl]-1,3-benzothiazol-3-ium-6-amine.
| Compound Name | 3-methyl-2-[(E)-2-(N-methylanilino)ethenyl]-1,3-benzothiazol-3-ium-6-amine |
|---|---|
| PubChem CID | 57316813 |
| Molecular Formula | C17H18N3S+ |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-methyl-2-[(E)-2-(N-methylanilino)ethenyl]-1,3-benzothiazol-3-ium-6-amine |
| SMILES | CN(/C=C/c1sc2cc(N)ccc2[n+]1C)c1ccccc1 |
| InChI | InChI=1S/C17H18N3S/c1-19(14-6-4-3-5-7-14)11-10-17-20(2)15-9-8-13(18)12-16(15)21-17/h3-12H,18H2,1-2H3/q+1 |
| InChIKey | XHYGQDMLFGOMPS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|