C65H48O5 — CID 57328817
2-tert-butyl-4,5,7,9,10-pentakis[2-(4-methoxyphenyl)ethynyl]pyrene (PubChem CID 57328817) has the molecular formula C65H48O5 and a molecular weight of 909.09 g/mol. Its IUPAC name is 2-tert-butyl-4,5,7,9,10-pentakis[2-(4-methoxyphenyl)ethynyl]pyrene.
| Compound Name | 2-tert-butyl-4,5,7,9,10-pentakis[2-(4-methoxyphenyl)ethynyl]pyrene |
|---|---|
| PubChem CID | 57328817 |
| Molecular Formula | C65H48O5 |
| Molecular Weight | 909.09 g/mol |
| Exact Mass | 908.35 |
| IUPAC Name | 2-tert-butyl-4,5,7,9,10-pentakis[2-(4-methoxyphenyl)ethynyl]pyrene |
| SMILES | COc1ccc(C#Cc2cc3c(C#Cc4ccc(OC)cc4)c(C#Cc4ccc(OC)cc4)c4cc(C(C)(C)C)cc5c(C#Cc6ccc(OC)cc6)c(C#Cc6ccc(OC)cc6)c(c2)c3c45)cc1 |
| InChI | InChI=1S/C65H48O5/c1-65(2,3)49-41-61-57(37-23-46-17-31-53(69-7)32-18-46)55(35-21-44-13-27-51(67-5)28-14-44)59-39-48(10-9-43-11-25-50(66-4)26-12-43)40-60-56(36-22-45-15-29-52(68-6)30-16-45)58(62(42-49)64(61)63(59)60)38-24-47-19-33-54(70-8)34-20-47/h11-20,25-34,39-42H,1-8H3 |
| InChIKey | MDXJKVFTHJUUMN-UHFFFAOYSA-N |
| XLogP | 12.92 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.09 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|