C13H21F2N2O5PS — CID 57343540
[1,1-difluoro-5-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)propylsulfanyl]pentyl]phosphonic acid (PubChem CID 57343540) has the molecular formula C13H21F2N2O5PS and a molecular weight of 386.36 g/mol. Its IUPAC name is [1,1-difluoro-5-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)propylsulfanyl]pentyl]phosphonic acid.
| Compound Name | [1,1-difluoro-5-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)propylsulfanyl]pentyl]phosphonic acid |
|---|---|
| PubChem CID | 57343540 |
| Molecular Formula | C13H21F2N2O5PS |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | [1,1-difluoro-5-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)propylsulfanyl]pentyl]phosphonic acid |
| SMILES | Cc1cn(CCCSCCCCC(F)(F)P(=O)(O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H21F2N2O5PS/c1-10-9-17(12(19)16-11(10)18)6-4-8-24-7-3-2-5-13(14,15)23(20,21)22/h9H,2-8H2,1H3,(H,16,18,19)(H2,20,21,22) |
| InChIKey | PVEKCFCKIIUAGS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|