C28H33I2NO5 — CID 57349086
2,2-dimethylpropyl 2-[3-[4-[2-(diethylamino)ethoxy]-3,5-diiodobenzoyl]-2-benzofuran-1-yl]acetate (PubChem CID 57349086) has the molecular formula C28H33I2NO5 and a molecular weight of 717.38 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[3-[4-[2-(diethylamino)ethoxy]-3,5-diiodobenzoyl]-2-benzofuran-1-yl]acetate.
| Compound Name | 2,2-dimethylpropyl 2-[3-[4-[2-(diethylamino)ethoxy]-3,5-diiodobenzoyl]-2-benzofuran-1-yl]acetate |
|---|---|
| PubChem CID | 57349086 |
| Molecular Formula | C28H33I2NO5 |
| Molecular Weight | 717.38 g/mol |
| Exact Mass | 717.04 |
| IUPAC Name | 2,2-dimethylpropyl 2-[3-[4-[2-(diethylamino)ethoxy]-3,5-diiodobenzoyl]-2-benzofuran-1-yl]acetate |
| SMILES | CCN(CC)CCOc1c(I)cc(C(=O)c2oc(CC(=O)OCC(C)(C)C)c3ccccc23)cc1I |
| InChI | InChI=1S/C28H33I2NO5/c1-6-31(7-2)12-13-34-27-21(29)14-18(15-22(27)30)25(33)26-20-11-9-8-10-19(20)23(36-26)16-24(32)35-17-28(3,4)5/h8-11,14-15H,6-7,12-13,16-17H2,1-5H3 |
| InChIKey | TUOBPPBVYUGZHH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.38 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|