C15H38IN3O4 — CID 57351981
N-butylcarbamate;bis(2-hydroxyethyl(trimethyl)azanium);iodide (PubChem CID 57351981) has the molecular formula C15H38IN3O4 and a molecular weight of 451.39 g/mol. Its IUPAC name is N-butylcarbamate;bis(2-hydroxyethyl(trimethyl)azanium);iodide.
| Compound Name | N-butylcarbamate;bis(2-hydroxyethyl(trimethyl)azanium);iodide |
|---|---|
| PubChem CID | 57351981 |
| Molecular Formula | C15H38IN3O4 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-butylcarbamate;bis(2-hydroxyethyl(trimethyl)azanium);iodide |
| SMILES | CCCCNC(=O)[O-].C[N+](C)(C)CCO.C[N+](C)(C)CCO.[I-] |
| InChI | InChI=1S/C5H11NO2.2C5H14NO.HI/c1-2-3-4-6-5(7)8;2*1-6(2,3)4-5-7;/h6H,2-4H2,1H3,(H,7,8);2*7H,4-5H2,1-3H3;1H/q;2*+1;/p-2 |
| InChIKey | URHWAZKGSUYBEX-UHFFFAOYSA-L |
| XLogP | -3.91 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|