C29H34ClN3O2 — CID 57361781
4-(4-benzhydryl-3-methylpiperazin-1-yl)butyl-(4-chlorophenyl)carbamic acid (PubChem CID 57361781) has the molecular formula C29H34ClN3O2 and a molecular weight of 492.06 g/mol. Its IUPAC name is 4-(4-benzhydryl-3-methylpiperazin-1-yl)butyl-(4-chlorophenyl)carbamic acid.
| Compound Name | 4-(4-benzhydryl-3-methylpiperazin-1-yl)butyl-(4-chlorophenyl)carbamic acid |
|---|---|
| PubChem CID | 57361781 |
| Molecular Formula | C29H34ClN3O2 |
| Molecular Weight | 492.06 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 4-(4-benzhydryl-3-methylpiperazin-1-yl)butyl-(4-chlorophenyl)carbamic acid |
| SMILES | CC1CN(CCCCN(C(=O)O)c2ccc(Cl)cc2)CCN1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34ClN3O2/c1-23-22-31(18-8-9-19-33(29(34)35)27-16-14-26(30)15-17-27)20-21-32(23)28(24-10-4-2-5-11-24)25-12-6-3-7-13-25/h2-7,10-17,23,28H,8-9,18-22H2,1H3,(H,34,35) |
| InChIKey | ONIGRGJRSBZFNG-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.06 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|