C14H16O3 — CID 57372499
2-[(2R,3R)-3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]but-2-enoic acid (PubChem CID 57372499) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-[(2R,3R)-3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]but-2-enoic acid.
| Compound Name | 2-[(2R,3R)-3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 57372499 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-[(2R,3R)-3-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl]but-2-enoic acid |
| SMILES | CC=C(C(=O)O)[C@H]1Cc2ccccc2C[C@H]1O |
| InChI | InChI=1S/C14H16O3/c1-2-11(14(16)17)12-7-9-5-3-4-6-10(9)8-13(12)15/h2-6,12-13,15H,7-8H2,1H3,(H,16,17)/t12-,13-/m1/s1 |
| InChIKey | JYCBTEURPHNNDD-CHWSQXEVSA-N |
| XLogP | 1.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|