C23H36N4O7 — CID 57379270
tert-butyl N-[2-[6-[3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propyl]-1,3-benzodioxol-5-yl]ethyl]carbamate (PubChem CID 57379270) has the molecular formula C23H36N4O7 and a molecular weight of 480.56 g/mol. Its IUPAC name is tert-butyl N-[2-[6-[3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propyl]-1,3-benzodioxol-5-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[6-[3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propyl]-1,3-benzodioxol-5-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 57379270 |
| Molecular Formula | C23H36N4O7 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | tert-butyl N-[2-[6-[3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propyl]-1,3-benzodioxol-5-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cc2c(cc1CCCOCCOCCOCCN=[N+]=[N-])OCO2 |
| InChI | InChI=1S/C23H36N4O7/c1-23(2,3)34-22(28)25-7-6-19-16-21-20(32-17-33-21)15-18(19)5-4-9-29-11-13-31-14-12-30-10-8-26-27-24/h15-16H,4-14,17H2,1-3H3,(H,25,28) |
| InChIKey | GQOABADZFNUOPW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|