C16H21NO3 — CID 57409427
(4R)-7,8-dimethoxy-2-methyl-4-prop-2-enyl-4,5-dihydro-1H-2-benzazepin-3-one (PubChem CID 57409427) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (4R)-7,8-dimethoxy-2-methyl-4-prop-2-enyl-4,5-dihydro-1H-2-benzazepin-3-one.
| Compound Name | (4R)-7,8-dimethoxy-2-methyl-4-prop-2-enyl-4,5-dihydro-1H-2-benzazepin-3-one |
|---|---|
| PubChem CID | 57409427 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (4R)-7,8-dimethoxy-2-methyl-4-prop-2-enyl-4,5-dihydro-1H-2-benzazepin-3-one |
| SMILES | C=CC[C@@H]1Cc2cc(OC)c(OC)cc2CN(C)C1=O |
| InChI | InChI=1S/C16H21NO3/c1-5-6-11-7-12-8-14(19-3)15(20-4)9-13(12)10-17(2)16(11)18/h5,8-9,11H,1,6-7,10H2,2-4H3/t11-/m1/s1 |
| InChIKey | NBOWWSMRDNGSID-LLVKDONJSA-N |
| XLogP | 2.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|