C17H19NO2 — CID 132540560
7,8-dimethoxy-10-prop-2-enyl-5,10-dihydropyrrolo[1,2-b]isoquinoline (PubChem CID 132540560) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 7,8-dimethoxy-10-prop-2-enyl-5,10-dihydropyrrolo[1,2-b]isoquinoline.
| Compound Name | 7,8-dimethoxy-10-prop-2-enyl-5,10-dihydropyrrolo[1,2-b]isoquinoline |
|---|---|
| PubChem CID | 132540560 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 7,8-dimethoxy-10-prop-2-enyl-5,10-dihydropyrrolo[1,2-b]isoquinoline |
| SMILES | C=CCC1c2cc(OC)c(OC)cc2Cn2cccc21 |
| InChI | InChI=1S/C17H19NO2/c1-4-6-13-14-10-17(20-3)16(19-2)9-12(14)11-18-8-5-7-15(13)18/h4-5,7-10,13H,1,6,11H2,2-3H3 |
| InChIKey | YROSADAKOSGNJN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|