C34H42ClNO3 — CID 57412489
(4-chlorophenyl)-[3-[[1-[(2S)-2-phenylmethoxyoctyl]piperidin-4-yl]methoxy]phenyl]methanone (PubChem CID 57412489) has the molecular formula C34H42ClNO3 and a molecular weight of 548.17 g/mol. Its IUPAC name is (4-chlorophenyl)-[3-[[1-[(2S)-2-phenylmethoxyoctyl]piperidin-4-yl]methoxy]phenyl]methanone.
| Compound Name | (4-chlorophenyl)-[3-[[1-[(2S)-2-phenylmethoxyoctyl]piperidin-4-yl]methoxy]phenyl]methanone |
|---|---|
| PubChem CID | 57412489 |
| Molecular Formula | C34H42ClNO3 |
| Molecular Weight | 548.17 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | (4-chlorophenyl)-[3-[[1-[(2S)-2-phenylmethoxyoctyl]piperidin-4-yl]methoxy]phenyl]methanone |
| SMILES | CCCCCC[C@@H](CN1CCC(COc2cccc(C(=O)c3ccc(Cl)cc3)c2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C34H42ClNO3/c1-2-3-4-8-13-33(39-25-27-10-6-5-7-11-27)24-36-21-19-28(20-22-36)26-38-32-14-9-12-30(23-32)34(37)29-15-17-31(35)18-16-29/h5-7,9-12,14-18,23,28,33H,2-4,8,13,19-22,24-26H2,1H3/t33-/m0/s1 |
| InChIKey | FRTOMFRKINDXNG-XIFFEERXSA-N |
| XLogP | 8.22 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.17 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|