C35H44Cl2N2O3 — CID 70684020
(1S)-1-[3-[[4-[[3-chloro-4-[(Z)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]methyl]phenyl]octan-1-ol (PubChem CID 70684020) has the molecular formula C35H44Cl2N2O3 and a molecular weight of 611.65 g/mol. Its IUPAC name is (1S)-1-[3-[[4-[[3-chloro-4-[(Z)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]methyl]phenyl]octan-1-ol.
| Compound Name | (1S)-1-[3-[[4-[[3-chloro-4-[(Z)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]methyl]phenyl]octan-1-ol |
|---|---|
| PubChem CID | 70684020 |
| Molecular Formula | C35H44Cl2N2O3 |
| Molecular Weight | 611.65 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | (1S)-1-[3-[[4-[[3-chloro-4-[(Z)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]methyl]phenyl]octan-1-ol |
| SMILES | CCCCCCC[C@H](O)c1cccc(CN2CCC(COc3ccc(/C(=N\OC)c4ccc(Cl)cc4)c(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C35H44Cl2N2O3/c1-3-4-5-6-7-11-34(40)29-10-8-9-27(22-29)24-39-20-18-26(19-21-39)25-42-31-16-17-32(33(37)23-31)35(38-41-2)28-12-14-30(36)15-13-28/h8-10,12-17,22-23,26,34,40H,3-7,11,18-21,24-25H2,1-2H3/b38-35-/t34-/m0/s1 |
| InChIKey | ILAUWTIQQVQLQX-ONHWOPKRSA-N |
| XLogP | 9.08 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.65 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|